| Name |
Pallidol 3,3''-diglucoside |
| Formula |
C40H42O16 |
| Mw |
778.2472853 |
| CAS RN |
285568-85-6 |
| C_ID |
C00064255
|
| InChIKey |
BYOGHJOVDNNJNN-FLBOZUSKSA-N |
| InChICode |
InChI=1S/C40H42O16/c41-13-25-33(47)35(49)37(51)39(55-25)53-19-9-21-29(23(45)11-19)27(15-1-5-17(43)6-2-15)31-22-10-20(54-40-38(52)36(50)34(48)26(14-42)56-40)12-24(46)30(22)28(32(21)31)16-3-7-18(44)8-4-16/h1-12,25-28,31-52H,13-14H2/t25-,26-,27-,28-,31+,32+,33-,34-,35+,36+,37-,38-,39-,40-/m1/s1 |
| SMILES |
OCC1OC(Oc2cc(O)c3c(c2)C2C(c4ccc(O)cc4)c4c(O)cc(OC5OC(CO)C(O)C(O)C5O)cc4C2C3c2ccc(O)cc2)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis labrusca  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis coignetiae | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|