| Name |
Indolenine |
| Formula |
C8H7N |
| Mw |
117.05784923 |
| CAS RN |
271-26-1 |
| C_ID |
C00064242
|
| InChIKey |
RKJUIXBNRJVNHR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-4,6H,5H2 |
| SMILES |
C1=Nc2ccccc2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Rauwolfia nitida | Ref. |
| Plantae | Apocynaceae | Rauwolfia vomitoria  | Ref. |
|
|
zoom in
| Organism | Rauwolfia nitida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|