| Name |
Amurensin D |
| Formula |
C42H30O9 |
| Mw |
678.18898256 |
| CAS RN |
265652-97-9 |
| C_ID |
C00064238
|
| InChIKey |
DXQABIMCAGCMLB-KLCMGBMYSA-N |
| InChICode |
InChI=1S/C42H30O9/c43-27-8-1-22(2-9-27)3-14-34-39-35(51-42(26-17-32(48)20-33(49)18-26)37(39)23-4-10-28(44)11-5-23)21-36-40(34)38(25-15-30(46)19-31(47)16-25)41(50-36)24-6-12-29(45)13-7-24/h1-21,38,41,43-49H/b14-3+/t38-,41+/m0/s1 |
| SMILES |
Oc1ccc(C=Cc2c3c(cc4oc(-c5cc(O)cc(O)c5)c(-c5ccc(O)cc5)c24)OC(c2ccc(O)cc2)C3c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|