| Name |
1,7-Dihydroxy-8-methoxy-2-methylanthraquinone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
261155-46-8 |
| C_ID |
C00064230
|
| InChIKey |
RZEBNJFTFOJTHP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-7-3-4-8-11(13(7)18)15(20)12-9(14(8)19)5-6-10(17)16(12)21-2/h3-6,17-18H,1-2H3 |
| SMILES |
COc1c(O)ccc2c1C(=O)c1c(ccc(C)c1O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
|
|
zoom in
| Organism | Morinda citrifolia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
