| Name |
Primcortusin |
| Formula |
C15H10O3 |
| Mw |
238.06299419 |
| CAS RN |
1800374-94-0 |
| C_ID |
C00064042
|
| InChIKey |
DZFPYTDYKXXHNB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O3/c16-13-10-14(11-6-2-1-3-7-11)18-15-12(13)8-4-5-9-17-15/h1-10H |
| SMILES |
O=c1cc(-c2ccccc2)oc2c1C=CC=CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Primulaceae | Primula cortusoides | Ref. |
| Plantae | Primulaceae | Primula glutinosa | Ref. |
|
|
zoom in
| Organism | Primula cortusoides | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|