| Name |
Ibericin |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
17526-17-9 |
| C_ID |
C00064032
|
| InChIKey |
VRARPPQMEQUQET-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-2-22-8-12-13(18)7-11-14(17(12)21)16(20)10-6-4-3-5-9(10)15(11)19/h3-7,18,21H,2,8H2,1H3 |
| SMILES |
CCOCc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
|
|
zoom in
| Organism | Morinda citrifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|