| Name |
Ambiguanine G |
| Formula |
C24H27NO7 |
| Mw |
441.17875222 |
| CAS RN |
1621607-93-9 |
| C_ID |
C00063967
|
| InChIKey |
LLZUFQMVABWHJD-FGCOXFRFSA-N |
| InChICode |
InChI=1S/C24H27NO7/c1-12(26)32-20-7-13-6-17(27-3)18(28-4)8-14(13)23-24(20,2)16-9-19(29-5)22-21(30-11-31-22)15(16)10-25-23/h6,8-9,20,23,25H,7,10-11H2,1-5H3/t20-,23+,24-/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)C1NCc3c(cc(OC)c4c3OCO4)C1(C)C(OC(C)=O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ambigua var. amurensis  | Ref. |
|
|
zoom in
| Organism | Corydalis ambigua var. amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|