| Name |
Ambiguanine F |
| Formula |
C26H31NO9 |
| Mw |
501.1998816 |
| CAS RN |
1621607-92-8 |
| C_ID |
C00063966
|
| InChIKey |
UUZOPHAMFAIFDI-RJHAJULLSA-N |
| InChICode |
InChI=1S/C26H31NO9/c1-13(29)36-21-8-14-7-18(31-4)19(32-5)9-15(14)26(30)25(21,2)16-10-20(33-6)23-24(35-12-34-23)22(16)17(11-28)27(26)3/h7,9-10,17,21,28,30H,8,11-12H2,1-6H3/t17-,21+,25+,26+/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)C1(O)N(C)C(CO)c3c(cc(OC)c4c3OCO4)C1(C)C(OC(C)=O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ambigua var. amurensis  | Ref. |
|
|
zoom in
| Organism | Corydalis ambigua var. amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|