| Name |
Ambiguanine C |
| Formula |
C22H25NO6 |
| Mw |
399.16818754 |
| CAS RN |
1621607-90-6 |
| C_ID |
C00063964
|
| InChIKey |
AFXLZVOTIUNSFR-BVYCBKJFSA-N |
| InChICode |
InChI=1S/C22H25NO6/c1-22-14-8-17(27-4)20-19(28-10-29-20)13(14)9-23(2)21(22)12-7-15(24)16(26-3)5-11(12)6-18(22)25/h5,7-8,18,21,24-25H,6,9-10H2,1-4H3/t18-,21+,22-/m1/s1 |
| SMILES |
COc1cc2c(cc1O)C1N(C)Cc3c(cc(OC)c4c3OCO4)C1(C)C(O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ambigua var. amurensis  | Ref. |
|
|
zoom in
| Organism | Corydalis ambigua var. amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|