| Name |
Quercetin 3-O-methyl ether peracetate |
| Formula |
C24H20O11 |
| Mw |
484.10056148 |
| CAS RN |
1486-69-7 |
| C_ID |
C00063907
|
| InChIKey |
IRJPBMYKKVBCHS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H20O11/c1-11(25)31-16-9-19(34-14(4)28)21-20(10-16)35-23(24(30-5)22(21)29)15-6-7-17(32-12(2)26)18(8-15)33-13(3)27/h6-10H,1-5H3 |
| SMILES |
COc1c(-c2ccc(OC(C)=O)c(OC(C)=O)c2)oc2cc(OC(C)=O)cc(OC(C)=O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Rhamnus nakaharai | Ref. |
|
|
zoom in
| Organism | Rhamnus nakaharai | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|