| Name |
Ambiguanine E |
| Formula |
C24H29NO7 |
| Mw |
443.19440229 |
| CAS RN |
1433460-94-6 |
| C_ID |
C00063872
|
| InChIKey |
XXFSRQGVSYKHSC-VTFKGUSZSA-N |
| InChICode |
InChI=1S/C24H29NO7/c1-24-14-9-18(30-5)21-22(32-11-31-21)20(14)15(10-26)25(2)23(24)13-8-17(29-4)16(28-3)6-12(13)7-19(24)27/h6,8-9,15,19,23,26-27H,7,10-11H2,1-5H3/t15-,19+,23-,24+/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)C1N(C)C(CO)c3c(cc(OC)c4c3OCO4)C1(C)C(O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ambigua var. amurensis  | Ref. |
|
|
zoom in
| Organism | Corydalis ambigua var. amurensis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
