| Name |
Marumoside B |
| Formula |
C20H29NO11 |
| Mw |
459.17406078 |
| CAS RN |
1309604-35-0 |
| C_ID |
C00063771
|
| InChIKey |
FFFJTYFSJLXDJC-XWZVJHGDSA-N |
| InChICode |
InChI=1S/C20H29NO11/c1-8-13(24)18(32-19-16(27)15(26)14(25)11(7-22)31-19)17(28)20(29-8)30-10-4-2-9(3-5-10)6-12(21)23/h2-5,8,11,13-20,22,24-28H,6-7H2,1H3,(H2,21,23)/t8-,11+,13-,14+,15-,16+,17+,18+,19-,20-/m0/s1 |
| SMILES |
CC1OC(Oc2ccc(CC(N)=O)cc2)C(O)C(OC2OC(CO)C(O)C(O)C2O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
|
|
zoom in
| Organism | Moringa oleifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|