| Name |
(-)-Papaveroxine Papaveroxine |
| Formula |
C22H25NO7 |
| Mw |
415.16310216 |
| CAS RN |
106982-92-7 |
| C_ID |
C00063622
|
| InChIKey |
JKLOZTFGRPYWHQ-MOPGFXCFSA-N |
| InChICode |
InChI=1S/C22H25NO7/c1-23-8-7-12-9-16-21(30-11-29-16)22(28-4)17(12)18(23)19(25)13-5-6-15(26-2)20(27-3)14(13)10-24/h5-6,9-10,18-19,25H,7-8,11H2,1-4H3/t18-,19+/m1/s1 |
| SMILES |
COc1ccc(C(O)C2c3c(cc4c(c3OC)OCO4)CCN2C)c(C=O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver fugax | Ref. |
| Plantae | Papaveraceae | Papaver pseudo-orientale | Ref. |
|
|
zoom in
| Organism | Papaver fugax | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|