| Name |
Amurensinine |
| Formula |
C20H21NO4 |
| Mw |
339.14705817 |
| CAS RN |
10470-47-0 |
| C_ID |
C00063611
|
| InChIKey |
CHGJYZLWIIUFAG-CVEARBPZSA-N |
| InChICode |
InChI=1S/C20H21NO4/c1-21-9-15-12-6-18(23-3)17(22-2)5-11(12)4-16(21)14-8-20-19(7-13(14)15)24-10-25-20/h5-8,15-16H,4,9-10H2,1-3H3/t15-,16+/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)C1CN(C)C(C2)c2cc3c(cc21)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver kerneri | Ref. |
| Plantae | Papaveraceae | Papaver tatricum | Ref. |
|
|
zoom in
| Organism | Papaver kerneri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|