| Name |
Viscozulenic acid methyl ester |
| Formula |
C17H24O5 |
| Mw |
308.16237388 |
| CAS RN |
1013930-86-3 |
| C_ID |
C00063594
|
| InChIKey |
DLEWZBMIRXCONF-PBOSXPJTSA-N |
| InChICode |
InChI=1S/C17H24O5/c1-9(2)12-7-13-10(5-6-11(13)16(19)21-3)14(8-15(12)18)17(20)22-4/h6,8-10,12-13,15,18H,5,7H2,1-4H3/t10-,12-,13+,15+/m1/s1 |
| SMILES |
COC(=O)C1=CC(O)C(C(C)C)CC2C(C(=O)OC)=CCC12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum viscosum | Ref. |
|
|
zoom in
| Organism | Polygonum viscosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|