| Name |
(E)-O-Methoxycinnamic acid |
| Formula |
C10H10O3 |
| Mw |
178.06299419 |
| CAS RN |
1011-54-7 |
| C_ID |
C00063588
|
| InChIKey |
FEGVSPGUHMGGBO-VOTSOKGWSA-N |
| InChICode |
InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6+ |
| SMILES |
COc1ccccc1C=CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
|
|
zoom in
| Organism | Scrophularia buergeriana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|