| Name |
Nudaurine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
4850-04-8 |
| C_ID |
C00063578
|
| InChIKey |
|
| InChICode |
InChI=1S/C27H26FN3O4/c1-3-18(2)19-6-12-23(13-7-19)35-16-15-30-14-4-5-22(30)17-24-25(32)29-27(34)31(26(24)33)21-10-8-20(28)9-11-21/h4-14,17-18H,3,15-16H2,1-2H3,(H,29,32,34);InChI=1S/C27H26FN3O4/c1-3-18(2)19-6-12-23(13-7-19)35-16-15-30-14-4-5-22(30)17-24-25(32)29-27(34)31(26(24)33)21-10-8-20(28)9-11-21/h4-14,17-18H,3,15-16H2,1-2H3,(H,29,32,34)/b24-17+ |
| SMILES |
CCC(C)c1ccc(OCCn2cccc2C=C2C(=O)NC(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver croceum | Ref. |
|
|
zoom in
| Organism | Papaver croceum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
