| Name |
Digallic acid m-Digallic acid |
| Formula |
C14H10O9 |
| Mw |
322.03248192 |
| CAS RN |
536-08-3 |
| C_ID |
C00062109
|
| InChIKey |
COVFEVWNJUOYRL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H10O9/c15-7-2-6(3-8(16)11(7)18)14(22)23-10-4-5(13(20)21)1-9(17)12(10)19/h1-4,15-19H,(H,20,21) |
| SMILES |
O=C(O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
|
|
zoom in
| Organism | Acacia nilotica | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|