| Name |
Quercetin 3-O-beta-D-rhamnoside Quercetin-3-O-beta-D-rhamnoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
494859-14-2 |
| C_ID |
C00061940
|
| InChIKey |
OXGUCUVFOIWWQJ-AIRRAIBWSA-N |
| InChICode |
InChI=1S/C21H20O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-18,21-26,28-29H,1H3/t7-,15-,17+,18+,21+/m1/s1 |
| SMILES |
CC1OC(Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
|
|
zoom in
| Organism | Stevia rebaudiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|