| Name |
(-)-alpha-bisabolone oxide A (S-(R*,R*))-Dihydro-2,2,6-trimethyl-6-(4-methyl-3-cyclohexen-1-yl)-2H-pyran-3(4H)-one |
| Formula |
C15H24O2 |
| Mw |
236.17763001 |
| CAS RN |
22567-38-0 |
| C_ID |
C00060907
|
| InChIKey |
MJWZYBQLHJQQJJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H24O2/c1-11-5-7-12(8-6-11)15(4)10-9-13(16)14(2,3)17-15/h5,12H,6-10H2,1-4H3/t12-,15+/m1/s1 |
| SMILES |
CC1=CCC(C2(C)CCC(=O)C(C)(C)O2)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
|
|
zoom in
| Organism | Chamomilla rectita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|