| Name |
Z-Guggulsterone |
| Formula |
C21H28O2 |
| Mw |
312.20893014 |
| CAS RN |
39025-23-5 |
| C_ID |
C00058817
|
| InChIKey |
WDXRGPWQVHZTQJ-OSJVMJFVSA-N |
| InChICode |
InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4+/t15-,17+,18+,20+,21-/m1/s1 |
| SMILES |
C/C=C1C(=O)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Burseraceae | Commiphora wightii | Ref. |
| Plantae | Simaroubaceae | Ailanthus grandis | Ref. |
|
|
zoom in
| Organism | Commiphora mukul |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
