| Name |
Guggulsterol I |
| Formula |
C27H44O4 |
| Mw |
432.32395989 |
| CAS RN |
39025-25-7 |
| C_ID |
C00058513
|
| InChIKey |
OOTWVICJYKMZRC-NAFFBZQJSA-N |
| InChICode |
InChI=1S/C27H44O4/c1-16(2)6-9-23(30)27(5,31)24-22(29)15-21-19-8-7-17-14-18(28)10-12-25(17,3)20(19)11-13-26(21,24)4/h14,16,19-24,29-31H,6-13,15H2,1-5H3/t19-,20+,21+,22+,23-,24+,25+,26+,27+/m1/s1 |
| SMILES |
CC(C)CC[C@@H](O)[C@](C)(O)[C@H]1[C@@H](O)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Simaroubaceae | Ailanthus grandis | Ref. |
|
|
zoom in
| Organism | Commiphora mukul | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|