| Name |
Neochlorogenin |
| Formula |
C27H44O4 |
| Mw |
432.32395989 |
| CAS RN |
511-91-1 |
| C_ID |
C00057419
|
| InChIKey |
PZNPHSFXILSZTM-UNARIRTPSA-N |
| InChICode |
InChI=1S/C27H44O4/c1-15-5-10-27(30-14-15)16(2)24-23(31-27)13-20-18-12-22(29)21-11-17(28)6-8-25(21,3)19(18)7-9-26(20,24)4/h15-24,28-29H,5-14H2,1-4H3/t15-,16-,17-,18+,19-,20-,21+,22-,23-,24-,25+,26-,27+/m0/s1 |
| SMILES |
C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4C[C@H](O)[C@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dioscoreaceae | Dioscorea tokoro | Ref. |
| Plantae | Solanaceae | Solanum torvum  | Ref. |
|
|
zoom in
| Organism | Dioscorea tokoro | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|