| Name |
Phygrine |
| Formula |
C16H28N2O2 |
| Mw |
280.21507815 |
| CAS RN |
148139-97-3 |
| C_ID |
C00057088
|
| InChIKey |
UBFAEXSSMSJTQV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H28N2O2/c1-12(19)9-14-6-7-15(18(14)3)11-16(20)10-13-5-4-8-17(13)2/h13-15H,4-11H2,1-3H3 |
| SMILES |
CC(=O)CC1CCC(CC(=O)CC2CCCN2C)N1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Physalis alkekengi  | Ref. |
| Plantae | Solanaceae | Physalis angulata  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| Plantae | Solanaceae | Physalis philadelphica  | Ref. |
| Plantae | Solanaceae | Physalis pruinosa | Ref. |
| Plantae | Solanaceae | Physalis pubescens  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus albus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|