| Name |
Tryptophan |
| Formula |
C11H12N2O2 |
| Mw |
204.08987764 |
| CAS RN |
54-12-6 |
| C_ID |
C00056269
|
| InChIKey |
QIVBCDIJIAJPQS-SECBINFHSA-N |
| InChICode |
InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| SMILES |
NC(Cc1c[nH]c2ccccc12)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
|
|
zoom in
| Organism | Colocasia esculenta | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|