| Name |
Racemofuran |
| Formula |
C17H16O4 |
| Mw |
284.104859 |
| CAS RN |
851983-04-5 |
| C_ID |
C00056096
|
| InChIKey |
SFRZABUAZGJIDG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H16O4/c1-9-13(8-14(20-3)10(2)17(9)19)16-6-11-4-5-12(18)7-15(11)21-16/h4-8,18-19H,1-3H3 |
| SMILES |
COc1cc(-c2cc3ccc(O)cc3o2)c(C)c(O)c1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Stemonaceae | Stemona collinsiae | Ref. |
|
|
zoom in
| Organism | Asparagus racemosus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|