| Name |
Morellinol |
| Formula |
C33H38O7 |
| Mw |
546.26175357 |
| CAS RN |
55452-65-8 |
| C_ID |
C00055988
|
| InChIKey |
UWZMGTSPGQXAAP-MSDOJSJISA-N |
| InChICode |
InChI=1S/C33H38O7/c1-17(2)8-9-21-27-20(11-12-30(4,5)38-27)25(35)24-26(36)22-14-19-15-23-31(6,7)40-32(29(19)37,13-10-18(3)16-34)33(22,23)39-28(21)24/h8,10-12,14,19,23,34-35H,9,13,15-16H2,1-7H3/b18-10-/t19-,23+,32+,33-/m1/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c1O[C@]14C(=C[C@@H]5C[C@H]1C(C)(C)O[C@@]4(C/C=C(/C)CO)C5=O)C3=O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hanburyi  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia morella  | Ref. |
|
|
zoom in
| Organism | Garcinia hanburyi | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|