| Name |
Isogaudichaudiic acid Isogaudichaudionic acid |
| Formula |
C33H38O8 |
| Mw |
562.25666819 |
| CAS RN |
1240566-16-8 |
| C_ID |
C00055947
|
| InChIKey |
AGLFUQQNMWKHEY-SAWBTQAISA-N |
| InChICode |
InChI=1S/C33H38O8/c1-16(2)8-10-20-25(34)21(11-9-17(3)4)28-24(26(20)35)27(36)22-14-19-15-23-31(6,7)41-32(29(19)37,33(22,23)40-28)13-12-18(5)30(38)39/h8-9,12,14,19,23,34-35H,10-11,13,15H2,1-7H3,(H,38,39)/b18-12+/t19-,23+,32+,33-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)C1=C[C@@H]3C[C@H]4C(C)(C)O[C@@](C/C=C(C)C(=O)O)(C3=O)[C@@]14O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hanburyi  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia lateriflora | Ref. |
|
|
zoom in
| Organism | Garcinia hanburyi | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|