| Name |
Garcihombronone B |
| Formula |
C23H24O7 |
| Mw |
412.15220312 |
| CAS RN |
1417886-72-6 |
| C_ID |
C00055866
|
| InChIKey |
KMODIHMAXVBYHP-NQADCFBISA-N |
| InChICode |
InChI=1S/C23H24O7/c1-11(2)14(24)7-5-12(3)4-6-13-17(27)10-18(28)20-21(29)19-15(25)8-9-16(26)23(19)30-22(13)20/h4,8-10,14,24-28H,1,5-7H2,2-3H3/b12-4+/t14-/m1/s1 |
| SMILES |
C=C(C)[C@H](O)CC/C(C)=C/Cc1c(O)cc(O)c2c(=O)c3c(O)ccc(O)c3oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nujiangensis | Ref. |
|
|
zoom in
| Organism | Garcinia hombroniana | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|