| Name |
Cheffouxanthone |
| Formula |
C23H24O6 |
| Mw |
396.1572885 |
| CAS RN |
947613-30-1 |
| C_ID |
C00055762
|
| InChIKey |
YCXJJRFCZHLOET-NTUHNPAUSA-N |
| InChICode |
InChI=1S/C23H24O6/c1-12(2)5-4-6-13(3)7-8-14-17(26)11-18(27)20-21(28)19-15(24)9-10-16(25)23(19)29-22(14)20/h5,7,9-11,24-27H,4,6,8H2,1-3H3/b13-7+ |
| SMILES |
CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)c2c(=O)c3c(O)ccc(O)c3oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia polyantha | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia smeathmannii | Ref. |
|
|
zoom in
| Organism | Garcinia polyantha | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|