| Name |
Aporphine |
| Formula |
C17H17N |
| Mw |
235.13609955 |
| CAS RN |
478-57-9 |
| C_ID |
C00055715
|
| InChIKey |
BZKUYNBAFQJRDM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H17N/c1-18-10-9-12-6-4-8-15-14-7-3-2-5-13(14)11-16(18)17(12)15/h2-8,16H,9-11H2,1H3 |
| SMILES |
CN1CCc2cccc3c2C1Cc1ccccc1-3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
|
|
zoom in
| Organism | Podophyllum peltatum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
