| Name |
2(4H)-benzofuranone |
| Formula |
C8H6O2 |
| Mw |
134.03677944 |
| CAS RN |
340025-95-8 |
| C_ID |
C00055651
|
| InChIKey |
PWPSOYGLESTGEU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H6O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-2,4-5H,3H2 |
| SMILES |
O=C1C=C2CC=CC=C2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|