| Name |
Bisacurone B |
| Formula |
C15H24O3 |
| Mw |
252.17254463 |
| CAS RN |
127214-85-1 |
| C_ID |
C00055415
|
| InChIKey |
QJOWFYQIUZMPRY-MXYBEHONSA-N |
| InChICode |
InChI=1S/C15H24O3/c1-10(2)7-13(16)8-11(3)12-5-6-15(4,18)14(17)9-12/h5-7,11-12,14,17-18H,8-9H2,1-4H3/t11-,12+,14+,15-/m0/s1 |
| SMILES |
CC(C)=CC(=O)C[C@H](C)[C@@H]1C=C[C@](C)(O)[C@H](O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|