| Name |
Curcumanolide A |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
97550-04-4 |
| C_ID |
C00055271
|
| InChIKey |
KHOTZHZBHNDKOB-CORIIIEPSA-N |
| InChICode |
InChI=1S/C15H22O2/c1-9(2)12-8-15(17-14(12)16)11(5)6-7-13(15)10(3)4/h11,13H,3,6-8H2,1-2,4-5H3/t11-,13-,15+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@H](C)[C@]12CC(=C(C)C)C(=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|