| Name |
Caraganin B
Cloversaponin II |
| Formula |
C36H54O11 |
| Mw |
662.36661257 |
| CAS RN |
143519-23-7 |
| C_ID |
C00055199
|
| InChIKey |
FSMNQWHKVQFXMJ-NRYKUPCLSA-N |
| InChICode |
InChI=1S/C36H54O11/c1-31(30(44)45)15-19-18-7-8-21-33(3)11-10-23(46-29-26(41)24(39)25(40)27(47-29)28(42)43)34(4,17-37)20(33)9-12-36(21,6)35(18,5)14-13-32(19,2)22(38)16-31/h7,19-21,23-27,29,37,39-41H,8-17H2,1-6H3,(H,42,43)(H,44,45)/t19-,20+,21+,23-,24-,25-,26+,27-,29+,31-,32+,33-,34+,35+,36+/m0/s1 |
| SMILES |
C[C@@]1(C(=O)O)CC(=O)[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]6O)[C@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Trifolium argutum | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
|
|
zoom in
| Organism | Trifolium argutum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
