| Name |
1,4-Bis-(3,4-dihydroxycinnamoyl)quinic acid 1,4-Dicaffeoylquinic acid |
| Formula |
C25H24O12 |
| Mw |
516.12677623 |
| CAS RN |
1182-34-9 |
| C_ID |
C00055091
|
| InChIKey |
IYXQRCXQQWUFQV-PSEXTPKNSA-N |
| InChICode |
InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(32)36-23-19(30)11-25(24(34)35,12-20(23)31)37-22(33)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-31H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23-,25+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@H](O)C[C@](OC(=O)/C=C/c2ccc(O)c(O)c2)(C(=O)O)C[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia herba-alba  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
|
|
zoom in
| Organism | Artemisia herba-alba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|