| Name |
Cycloeucalenone |
| Formula |
C30H48O |
| Mw |
424.37051615 |
| CAS RN |
1255-12-5 |
| C_ID |
C00054340
|
| InChIKey |
NFRXSIOHGADFRG-MEMZBLDGSA-N |
| InChICode |
InChI=1S/C30H48O/c1-19(2)20(3)8-9-21(4)23-12-14-28(7)26-11-10-24-22(5)25(31)13-15-29(24)18-30(26,29)17-16-27(23,28)6/h19,21-24,26H,3,8-18H2,1-2,4-7H3/t21-,22+,23-,24+,26+,27-,28+,29-,30+/m1/s1 |
| SMILES |
C=C(CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4[C@H](C)C(=O)CC[C@@]45C[C@@]35CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Musaceae | Musa sapientum  | Ref. |
| Plantae | Solanaceae | Solanum cernuum | Ref. |
|
|
zoom in
| Organism | Tinospora crispa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|