| Name |
Alkaloid RW47 Venoterpine |
| Formula |
C9H11NO |
| Mw |
149.08406398 |
| CAS RN |
17948-42-4 |
| C_ID |
C00054142
|
| InChIKey |
IOIGOIPHPUCFOB-IMTBSYHQSA-N |
| InChICode |
InChI=1S/C9H11NO/c1-6-8-5-10-3-2-7(8)4-9(6)11/h2-3,5-6,9,11H,4H2,1H3/t6-,9+/m1/s1 |
| SMILES |
C[C@@H]1c2cnccc2C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Gentianaceae | Gentiana lutea  | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|