| Name |
Dehydrozingerone |
| Formula |
C11H12O3 |
| Mw |
192.07864425 |
| CAS RN |
1080-12-2 |
| C_ID |
C00053959
|
| InChIKey |
AFWKBSMFXWNGRE-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C11H12O3/c1-8(12)3-4-9-5-6-10(13)11(7-9)14-2/h3-7,13H,1-2H3/b4-3+ |
| SMILES |
COc1cc(/C=C/C(C)=O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|