| Name |
Gaudichaudione A |
| Formula |
C33H38O7 |
| Mw |
546.26175357 |
| CAS RN |
208455-09-8 |
| C_ID |
C00053244
|
| InChIKey |
NTZQQDZXDGOJFE-XDHOZWIPSA-N |
| InChICode |
InChI=1S/C33H38O7/c1-17(2)8-10-21-26(35)22(11-9-18(3)4)29-25(27(21)36)28(37)23-14-20-15-24-31(6,7)40-32(30(20)38,33(23,24)39-29)13-12-19(5)16-34/h8-9,12,14,16,20,24,35-36H,10-11,13,15H2,1-7H3/b19-12+ |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)C1=CC3CC4C(C)(C)OC(C/C=C(C)C=O)(C3=O)C14O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia gaudichaudii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hanburyi  | Ref. |
|
|
zoom in
| Organism | Garcinia gaudichaudii | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|