| Name |
Garciduol A |
| Formula |
C27H18O9 |
| Mw |
486.09508217 |
| CAS RN |
176257-85-5 |
| C_ID |
C00053203
|
| InChIKey |
MLZDXLKUYJKGMA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C27H18O9/c1-35-18-11-15(29)21(23(31)12-6-3-2-4-7-12)25(33)19(18)13-10-16(30)27-22(24(13)32)26(34)20-14(28)8-5-9-17(20)36-27/h2-11,28-30,32-33H,1H3 |
| SMILES |
COc1cc(O)c(C(=O)c2ccccc2)c(O)c1-c1cc(O)c2oc3cccc(O)c3c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
|
|
zoom in
| Organism | Garcinia bracteata |
|---|
| Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|
