| Name |
chamomillol Chamomillol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
86341-93-7 |
| C_ID |
C00053147
|
| InChIKey |
MUROKQYXIPVTGD-QPSCCSFWSA-N |
| InChICode |
InChI=1S/C15H26O/c1-10(2)15(16)8-7-12(4)13-6-5-11(3)9-14(13)15/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13+,14+,15+/m1/s1 |
| SMILES |
CC1=C[C@H]2[C@@H](CC1)[C@H](C)CC[C@]2(O)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Chamomilla recutina | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
|
|
zoom in
| Organism | Chamomilla rectita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|