| Name |
Dulxanthone C |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
4178-45-4 |
| C_ID |
C00053081
|
| InChIKey |
ZAAAUPCCIDWPPI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H28O6/c1-13(2)7-9-15-11-19(30-6)22(27)25-20(15)23(28)21-17(26)12-18(29-5)16(24(21)31-25)10-8-14(3)4/h7-8,11-12,26-27H,9-10H2,1-6H3 |
| SMILES |
COc1cc(CC=C(C)C)c2c(=O)c3c(O)cc(OC)c(CC=C(C)C)c3oc2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia assigu | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
|
|
zoom in
| Organism | Garcinia assigu | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|