| Name |
4(3H)-Quinazolinone 4-Hydroxyquinazoline |
| Formula |
C8H6N2O |
| Mw |
146.04801283 |
| CAS RN |
491-36-1 |
| C_ID |
C00052719
|
| InChIKey |
QMNUDYFKZYBWQX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H6N2O/c11-8-6-3-1-2-4-7(6)9-5-10-8/h1-5H,(H,9,10,11) |
| SMILES |
O=c1nc[nH]c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Strobilanthes cusia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|