| Name |
2,4,7-Trihydroxyxanthone |
| Formula |
C13H8O5 |
| Mw |
244.03717337 |
| CAS RN |
188481-50-7 |
| C_ID |
C00052592
|
| InChIKey |
SFAGKFRVHJIURG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H10O4/c15-8-2-1-7-3-11-12(14(18)10(7)4-8)5-9(16)6-13(11)17/h1-2,4-6,15-17H,3H2 |
| SMILES |
O=C1c2cc(O)ccc2Cc2c(O)cc(O)cc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia cantleyana | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
|
|
zoom in
| Organism | Garcinia cantleyana | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|