| Name |
(-)-Isoguaiacin Isoguaiacin |
| Formula |
C20H24O4 |
| Mw |
328.16745925 |
| CAS RN |
78341-26-1 |
| C_ID |
C00052453
|
| InChIKey |
TZAAYUCUPIYQBR-FKANQGBASA-N |
| InChICode |
InChI=1S/C20H24O4/c1-11-7-14-9-19(24-4)17(22)10-15(14)20(12(11)2)13-5-6-16(21)18(8-13)23-3/h5-6,8-12,20-22H,7H2,1-4H3/t11-,12-,20-/m1/s1 |
| SMILES |
COc1cc([C@@H]2c3cc(O)c(OC)cc3C[C@@H](C)[C@H]2C)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Terminalia bellirica  | Ref. |
| Plantae | Combretaceae | Terminalia sericea  | Ref. |
| Plantae | Combretaceae | Terminalia superb | Ref. |
| Plantae | Lauraceae | Machilus thunbergii  | Ref. |
|
|
zoom in
| Organism | Terminalia bellirica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|