| Name |
Fenchyl acetate |
| Formula |
C12H20O2 |
| Mw |
196.14632988 |
| CAS RN |
13851-11-1 |
| C_ID |
C00052277
|
| InChIKey |
JUWUWIGZUVEFQB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H20O2/c1-8(13)14-10-11(2,3)9-5-6-12(10,4)7-9/h9-10H,5-7H2,1-4H3 |
| SMILES |
CC(=O)OC1C2(C)CCC(C2)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes ixiocephala | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
|
|
zoom in
| Organism | Strobilanthes ixiocephala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|