| Name |
20-O-Acetylcamptothecin |
| Formula |
C22H18N2O5 |
| Mw |
390.1215717 |
| CAS RN |
7688-64-4 |
| C_ID |
C00052111
|
| InChIKey |
SFRPDRJJDGZBBN-SANMLTNESA-N |
| InChICode |
InChI=1S/C26H26N2O5/c1-3-5-6-11-22(29)33-26(4-2)19-13-21-23-17(12-16-9-7-8-10-20(16)27-23)14-28(21)24(30)18(19)15-32-25(26)31/h7-10,12-13H,3-6,11,14-15H2,1-2H3/t26-/m0/s1 |
| SMILES |
CCCCCC(=O)O[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Icacinaceae | Nothapodytes foetida (Wight)Sleumer | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|