| Name |
N-Isopentenyl-6-hydroxydendroxine |
| Formula |
C22H34NO4 |
| Mw |
376.24878358 |
| CAS RN |
34222-69-0 |
| C_ID |
C00051700
|
| InChIKey |
JEFKEMSBOGQGDS-ORUFMNSINA-M |
| InChICode |
InChI=1S/C22H34NO4.ClH/c1-13(2)7-9-23-10-11-26-22(23)18-16(14(3)4)17(19(24)27-18)21(25)8-6-15(12-23)20(21,22)5;/h7,14-18,25H,6,8-12H2,1-5H3;1H/q+1;/p-1/t15-,16+,17-,18-,20+,21-,22+,23-;/m1./s1 |
| SMILES |
CC(C)=CC[N@+]12CCO[C@]13[C@@H]1OC(=O)[C@@H](C1C(C)C)[C@]1(O)CC[C@H](C2)[C@@]13C.[Cl-] |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Orchidaceae | Dendrobium nobile  | Ref. |
|
|
zoom in
| Organism | Dendrobium nobile |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
