| Name |
N-Isopentenyl dendrobine |
| Formula |
C21H34NO2 |
| Mw |
332.25895434 |
| CAS RN |
50304-67-1 |
| C_ID |
C00051699
|
| InChIKey |
CBXLZVMMZKKOHY-LWXWTCHWNA-N |
| InChICode |
InChI=1S/C21H34NO2/c1-12(2)9-10-22(6)11-14-7-8-15-17-16(13(3)4)18(24-20(17)23)19(22)21(14,15)5/h9-10,12-19H,7-8,11H2,1-6H3/q+1/t14-,15+,16+,17-,18-,19-,21+,22?/m1/s1 |
| SMILES |
CC(C)/C=C/[N+]1(C)C[C@H]2CC[C@H]3[C@H]4C(=O)O[C@@H](C1[C@@]23C)[C@H]4C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Orchidaceae | Dendrobium nobile  | Ref. |
|
|
zoom in
| Organism | Dendrobium nobile | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|